Products 70685-06-2
CAS 70685-06-2 is the registry number for 4-(5-Chloro-2-thienyl)-4-oxobutyric acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g.
4-(5-chlorothiophen-2-yl)-4-oxobutanoic acid (CAS 70685-06-2) is a chemical compound with the molecular formula C8H7ClO3S and a molecular weight of 218.66 g/mol. IUPAC name: 4-(5-chlorothiophen-2-yl)-4-oxobutanoic acid. InChIKey: QVRXRXKGJQLWMJ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3S |
|---|---|
| Molecular weight | 218.66 g/mol |
| IUPAC name | 4-(5-chlorothiophen-2-yl)-4-oxobutanoic acid |
| InChIKey | QVRXRXKGJQLWMJ-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Cl)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(5-chlorothiophen-2-yl)-4-oxobutanoic acid, 4-(5-Chloro-2-thienyl)-4-oxobutyric acid, Enamine_005167, 2-Thiophenebutanoicacid, 5-chloro-g-oxo-, QVRXRXKGJQLWMJ-UHFFFAOYSA-N, 5-Chloro-|A-oxo-2-thiophenebutanoic acid, 4-(5-chloro-2-thienyl)-4-ketobutyric acid, 5-Chloro-gamma-oxo-2-thiophenebutanoic acid, 4-(5-chloro(2-thienyl))-4-oxobutanoic acid, 4-(5-chloro-2-thienyl)-4-oxo-butanoic acid