CAS 953408-82-7 appears in our catalog under these names: 2,3-Dihydrobenzofuran-7-sulfonyl chloride, 95%, 2,3-Dihydro-1-benzofuran-7-sulfonyl chloride, 2,3-Dihydrobenzofuran-7-sulfonyl Chloride, 95%, 95%, 2,3-Dihydro-1-benzofuran-7-sulfonyl chloride, 95%, 2,3-Dihydro-1-benzofuran-7-sulfonyl chloride, 97% . Offered by: AmBeed, Biosynth, Chemat, Combi-blocks, Thermo Scientific. Available pack sizes: 10g, 5g, 250mg, 1g, 0,5g, 100mg.
2,3-dihydro-1-benzofuran-7-sulfonyl chloride (CAS 953408-82-7) is a chemical compound with the molecular formula C8H7ClO3S and a molecular weight of 218.66 g/mol. IUPAC name: 2,3-dihydro-1-benzofuran-7-sulfonyl chloride. InChIKey: UNECAYDZDLGSLP-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3S |
|---|---|
| Molecular weight | 218.66 g/mol |
| IUPAC name | 2,3-dihydro-1-benzofuran-7-sulfonyl chloride |
| InChIKey | UNECAYDZDLGSLP-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=CC=C2S(=O)(=O)Cl |
Computed by PubChem (NCBI)