Products 1788-10-9
CAS 1788-10-9 appears in our catalog under these names: 4-Acetylbenzenesulfonyl Chloride, 4-Acetylbenzenesulfonyl chloride, 97%, 4-Acetylbenzenesulfonyl chloride 97%, 4-ACETYLBENZENESULFONYL CHLORIDE, >=95.0, 4-Acetylbenzenesulfonyl chloride, 95%. Offered by: TRC, Biosynth, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 25g, 10g, 5g, 50g, 100g.
4-acetylbenzenesulfonyl chloride (CAS 1788-10-9) is a chemical compound with the molecular formula C8H7ClO3S and a molecular weight of 218.66 g/mol. IUPAC name: 4-acetylbenzenesulfonyl chloride. InChIKey: FXVDNCRTKXMSEZ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3S |
|---|---|
| Molecular weight | 218.66 g/mol |
| IUPAC name | 4-acetylbenzenesulfonyl chloride |
| InChIKey | FXVDNCRTKXMSEZ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-Acetylbenzenesulfonyl chloride, 4-Acetylbenzene-1-sulfonyl chloride, Benzenesulfonyl chloride, 4-acetyl-, 4-Acetyl-benzenesulfonyl chloride, 4-acetylbenzenesulphonyl chloride, 4-AcetylbenzenesulfonylChloride, 1-acetyl-4-(chlorosulfonyl)benzene, 4-acetylphenylsulfonyl chloride, Acetophenone-4-sulfonyl chloride, 4-acetylbenzene sulfonyl chloride