Products 1196151-28-6
CAS 1196151-28-6 is the registry number for (4-Formylphenyl)methanesulfonyl Chloride. Offered by: TRC. Available pack sizes: 100mg.
(4-formylphenyl)methanesulfonyl chloride (CAS 1196151-28-6) is a chemical compound with the molecular formula C8H7ClO3S and a molecular weight of 218.66 g/mol. IUPAC name: (4-formylphenyl)methanesulfonyl chloride. InChIKey: TUYACRWBDYWSGY-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3S |
|---|---|
| Molecular weight | 218.66 g/mol |
| IUPAC name | (4-formylphenyl)methanesulfonyl chloride |
| InChIKey | TUYACRWBDYWSGY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CS(=O)(=O)Cl)C=O |
Computed by PubChem (NCBI)