CAS 115010-11-2 appears in our catalog under these names: 2,3–Dihydrobenzofuran–5–sulfonyl Chloride, 2,3-Dihydrobenzo¬b|furan-5-sulfonyl chloride, 97% , 2,3-Dihydrobenzofuran-5-sulfonyl Chloride, >98.0%(GC), 2,3-Dihydro-1-benzofuran-5-sulfonyl chloride, 97% , 2,3-Dihydro-1-benzofuran-5-sulfonoylchloride 96%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific, Ambeed. Available pack sizes: 25g, 5g, 250mg, 1g, 10g, 100mg.
2,3-dihydro-1-benzofuran-5-sulfonyl chloride (CAS 115010-11-2) is a chemical compound with the molecular formula C8H7ClO3S and a molecular weight of 218.66 g/mol. IUPAC name: 2,3-dihydro-1-benzofuran-5-sulfonyl chloride. InChIKey: RVWYPBARHGPULM-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3S |
|---|---|
| Molecular weight | 218.66 g/mol |
| IUPAC name | 2,3-dihydro-1-benzofuran-5-sulfonyl chloride |
| InChIKey | RVWYPBARHGPULM-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)