CAS 40913-92-6 appears in our catalog under these names: 4-(Methanesulfonyl)benzoyl chloride, 96%, 4-(Methanesulfonyl)benzoyl chloride 95%, 4-(Methanesulfonyl)benzoyl chloride, 95%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
4-methylsulfonylbenzoyl chloride (CAS 40913-92-6) is a chemical compound with the molecular formula C8H7ClO3S and a molecular weight of 218.66 g/mol. IUPAC name: 4-methylsulfonylbenzoyl chloride. InChIKey: IPEIDGXNXFPGBG-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3S |
|---|---|
| Molecular weight | 218.66 g/mol |
| IUPAC name | 4-methylsulfonylbenzoyl chloride |
| InChIKey | IPEIDGXNXFPGBG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C(=O)Cl |
Computed by PubChem (NCBI)