CAS 1378864-51-7 appears in our catalog under these names: 2-Chloro-6-(methylsulfonyl)benzaldehyde, 95+%, 2-Chloro-6-methanesulfonylbenzaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-chloro-6-methylsulfonylbenzaldehyde (CAS 1378864-51-7) is a chemical compound with the molecular formula C8H7ClO3S and a molecular weight of 218.66 g/mol. IUPAC name: 2-chloro-6-methylsulfonylbenzaldehyde. InChIKey: GZYLETUVWATVLD-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3S |
|---|---|
| Molecular weight | 218.66 g/mol |
| IUPAC name | 2-chloro-6-methylsulfonylbenzaldehyde |
| InChIKey | GZYLETUVWATVLD-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C(=CC=C1)Cl)C=O |
Computed by PubChem (NCBI)