CAS 73035-16-2 appears in our catalog under these names: 3-Acetylbenzenesulfonyl chloride, 95%, 3–Acetylbenzenesulfonyl chloride, 3-Acetylbenzenesulfonyl chloride, 97% . Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg.
3-acetylbenzenesulfonyl chloride (CAS 73035-16-2) is a chemical compound with the molecular formula C8H7ClO3S and a molecular weight of 218.66 g/mol. IUPAC name: 3-acetylbenzenesulfonyl chloride. InChIKey: CGMBNEIGZOCPPP-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3S |
|---|---|
| Molecular weight | 218.66 g/mol |
| IUPAC name | 3-acetylbenzenesulfonyl chloride |
| InChIKey | CGMBNEIGZOCPPP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)