cas: 1395417-65-8 — see every product listed under this CAS number, including other names
2,4-DIFLUORO-5-METHOXYPHENYLBORONIC ACID, 97% (CAS 1395417-65-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F533430-100MG |
| cas | 1395417-65-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 362.39 Pln | |
| Fluorochem | 250mg | 575.86 Pln | |
| Fluorochem | 1g | 794.53 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2,4-difluoro-5-methoxyphenyl)boronic acid (CAS 1395417-65-8) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (2,4-difluoro-5-methoxyphenyl)boronic acid. InChIKey: LPDXDGZARPKGCF-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | (2,4-difluoro-5-methoxyphenyl)boronic acid |
| InChIKey | LPDXDGZARPKGCF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)F)OC)(O)O |
Computed by PubChem (NCBI)