2,4-Dibromoquinazoline, 95%
cas: 872998-61-3 — see every product listed under this CAS number, including other names
2,4-Dibromoquinazoline, 95% (CAS 872998-61-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100g, 1g, 10g, 250mg, 100mg. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | QA-0816-5g |
| cas | 872998-61-3 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 100g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 523.79 Pln | |
| Fluorochem | 5g | 2267.97 Pln | |
| Fluorochem | 10g | 3225.97 Pln | |
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 748.62 Pln | |
| Ambeed | 5g | 2450.75 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 1331.60 Pln | |
| BLDpharm | 250mg | 325.47 Pln | |
| BLDpharm | 1g | 803.08 Pln | |
| BLDpharm | 5g | 2635.76 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2,4-dibromoquinazoline (CAS 872998-61-3) is a chemical compound with the molecular formula C8H4Br2N2 and a molecular weight of 287.94 g/mol. IUPAC name: 2,4-dibromoquinazoline. InChIKey: CDBAGRHVFMGOON-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2 |
|---|---|
| Molecular weight | 287.94 g/mol |
| IUPAC name | 2,4-dibromoquinazoline |
| InChIKey | CDBAGRHVFMGOON-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=N2)Br)Br |
Computed by PubChem (NCBI)
Synonyms:
2,4-dibromoquinazoline