cas: 379229-30-8 — see every product listed under this CAS number, including other names
2,4-Dichloro-5-methoxyaniline hydrochloride, 95+% (CAS 379229-30-8) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A403109-500g |
| cas | 379229-30-8 |
| size | 500g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 500g | 8413.74 Pln | |
| AmBeed | 1g | 154.63 Pln | |
| AmBeed | 5g | 278.32 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,4-dichloro-5-methoxyaniline;hydrochloride (CAS 379229-30-8) is a chemical compound with the molecular formula C7H8Cl3NO and a molecular weight of 228.5 g/mol. IUPAC name: 2,4-dichloro-5-methoxyaniline;hydrochloride. InChIKey: NYMNXZXMNGXNIF-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl3NO |
|---|---|
| Molecular weight | 228.5 g/mol |
| IUPAC name | 2,4-dichloro-5-methoxyaniline;hydrochloride |
| InChIKey | NYMNXZXMNGXNIF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)N)Cl)Cl.Cl |
Computed by PubChem (NCBI)