CAS 916213-68-8 is the registry number for 4-(Aminomethyl)-2,6-dichlorophenol hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g.
4-(aminomethyl)-2,6-dichlorophenol;hydrochloride (CAS 916213-68-8) is a chemical compound with the molecular formula C7H8Cl3NO and a molecular weight of 228.5 g/mol. IUPAC name: 4-(aminomethyl)-2,6-dichlorophenol;hydrochloride. InChIKey: UZSYLONLGWIXCG-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl3NO |
|---|---|
| Molecular weight | 228.5 g/mol |
| IUPAC name | 4-(aminomethyl)-2,6-dichlorophenol;hydrochloride |
| InChIKey | UZSYLONLGWIXCG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)O)Cl)CN.Cl |
Computed by PubChem (NCBI)