Products 1885-52-5
CAS 1885-52-5 appears in our catalog under these names: O–(2，6–Dichlorobenzyl)hydroxylamine hydrochloride, O-(2,6-Dichlorobenzyl)hydroxylamine hydrochloride, 97%. Offered by: GLPBio, Ambeed. Available pack sizes: 250mg, 1g, 5g.
O-[(2,6-dichlorophenyl)methyl]hydroxylamine;hydrochloride (CAS 1885-52-5) is a chemical compound with the molecular formula C7H8Cl3NO and a molecular weight of 228.5 g/mol. IUPAC name: O-[(2,6-dichlorophenyl)methyl]hydroxylamine;hydrochloride. InChIKey: ZZAXSKXALNKDRJ-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl3NO |
|---|---|
| Molecular weight | 228.5 g/mol |
| IUPAC name | O-[(2,6-dichlorophenyl)methyl]hydroxylamine;hydrochloride |
| InChIKey | ZZAXSKXALNKDRJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CON)Cl.Cl |
Computed by PubChem (NCBI)