CAS 139460-29-0 appears in our catalog under these names: Benzenemethanamine, 2,4-dichloro-N-hydroxy-, hydrochloride (1:1), 95%, 95%, N-(2,4-Dichlorobenzyl)hydroxylamine hydrochloride, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
N-[(2,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride (CAS 139460-29-0) is a chemical compound with the molecular formula C7H8Cl3NO and a molecular weight of 228.5 g/mol. IUPAC name: N-[(2,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride. InChIKey: RYKQXFMRIUYEHT-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl3NO |
|---|---|
| Molecular weight | 228.5 g/mol |
| IUPAC name | N-[(2,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride |
| InChIKey | RYKQXFMRIUYEHT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CNO.Cl |
Computed by PubChem (NCBI)