CAS 1279870-54-0 appears in our catalog under these names: 2-(Aminomethyl)-4,6-dichlorophenol hydrochloride, 95%, 2-(Aminomethyl)-4,6-dichlorophenol hydrochloride, 2-(Aminomethyl)-4,6-dichlorophenol hydrochloride, 95%, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
2-(aminomethyl)-4,6-dichlorophenol;hydrochloride (CAS 1279870-54-0) is a chemical compound with the molecular formula C7H8Cl3NO and a molecular weight of 228.5 g/mol. IUPAC name: 2-(aminomethyl)-4,6-dichlorophenol;hydrochloride. InChIKey: QHSVFTFXNICJBZ-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl3NO |
|---|---|
| Molecular weight | 228.5 g/mol |
| IUPAC name | 2-(aminomethyl)-4,6-dichlorophenol;hydrochloride |
| InChIKey | QHSVFTFXNICJBZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CN)O)Cl)Cl.Cl |
Computed by PubChem (NCBI)