CAS 51572-93-1 appears in our catalog under these names: O–(2,4–Dichlorobenzyl)hydroxylamine hydrochloride, O-(2,4-Dichlorobenzyl)hydroxylamine hydrochloride, 97%, 97%, O-(2,4-DICHLOROBENZYL)HYDROXYLAMINE HCL, 96%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 25g, 10g.
O-[(2,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride (CAS 51572-93-1) is a chemical compound with the molecular formula C7H8Cl3NO and a molecular weight of 228.5 g/mol. IUPAC name: O-[(2,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride. InChIKey: HFZNWDNDGDEBBV-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl3NO |
|---|---|
| Molecular weight | 228.5 g/mol |
| IUPAC name | O-[(2,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride |
| InChIKey | HFZNWDNDGDEBBV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CON.Cl |
Computed by PubChem (NCBI)