CAS 76872-23-6 appears in our catalog under these names: 2,4-Dichloro-6-methylthieno[2,3-d]pyrimidine, 98%, 98%, 2,4-Dichloro-6-methylthieno[2,3-d]pyrimidine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,4-dichloro-6-methylthieno[2,3-d]pyrimidine (CAS 76872-23-6) is a chemical compound with the molecular formula C7H4Cl2N2S and a molecular weight of 219.09 g/mol. IUPAC name: 2,4-dichloro-6-methylthieno[2,3-d]pyrimidine. InChIKey: BTGNDWIMNVJZJY-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2S |
|---|---|
| Molecular weight | 219.09 g/mol |
| IUPAC name | 2,4-dichloro-6-methylthieno[2,3-d]pyrimidine |
| InChIKey | BTGNDWIMNVJZJY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(S1)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)