Products 35265-82-8
CAS 35265-82-8 appears in our catalog under these names: 2,4-dichloro-6-methylthieno(3,2-d)pyrimidine, 2,4-Dichloro-6-methylthieno[3,2-d]pyrimidine 95%, 2，4-Dichloro-6-methylthieno[3，2-d]pyrimidine, 92%, 92%, 2,4-Dichloro-6-methylthieno[3,2-d]pyrimidine, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g, 25g, 100mg.
2,4-dichloro-6-methylthieno[3,2-d]pyrimidine (CAS 35265-82-8) is a chemical compound with the molecular formula C7H4Cl2N2S and a molecular weight of 219.09 g/mol. IUPAC name: 2,4-dichloro-6-methylthieno[3,2-d]pyrimidine. InChIKey: ZDKZDOFEASCBMV-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2S |
|---|---|
| Molecular weight | 219.09 g/mol |
| IUPAC name | 2,4-dichloro-6-methylthieno[3,2-d]pyrimidine |
| InChIKey | ZDKZDOFEASCBMV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(S1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)