Products 35265-83-9

CAS 35265-83-9 appears in our catalog under these names: 2,4–dichloro–7–methylthieno(3,2–d)pyrimidine, 2,4-Dichloro-7-methylthieno[3,2-d]pyrimidine 97%, 2,4-Dichloro-7-methylthieno[3,2-d]pyrimidine, 97%, 97%, 2,4-Dichloro-7-methylthieno[3,2-d]pyrimidine, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100g, 100mg, 10g, 25g.

Structural formula: {0} (CAS {1})

2,4-dichloro-7-methylthieno[3,2-d]pyrimidine (CAS 35265-83-9) is a chemical compound with the molecular formula C7H4Cl2N2S and a molecular weight of 219.09 g/mol. IUPAC name: 2,4-dichloro-7-methylthieno[3,2-d]pyrimidine. InChIKey: WUXYWALKGQDXFI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4Cl2N2S
Molecular weight219.09 g/mol
IUPAC name2,4-dichloro-7-methylthieno[3,2-d]pyrimidine
InChIKeyWUXYWALKGQDXFI-UHFFFAOYSA-N
SMILESCC1=CSC2=C1N=C(N=C2Cl)Cl

Computed by PubChem (NCBI)