CAS 70200-94-1 is the registry number for 2,7-Dichlorobenzo(d)thiazol-6-amine, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2,7-dichloro-1,3-benzothiazol-6-amine (CAS 70200-94-1) is a chemical compound with the molecular formula C7H4Cl2N2S and a molecular weight of 219.09 g/mol. IUPAC name: 2,7-dichloro-1,3-benzothiazol-6-amine. InChIKey: MNORRHJKCKZESK-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2S |
|---|---|
| Molecular weight | 219.09 g/mol |
| IUPAC name | 2,7-dichloro-1,3-benzothiazol-6-amine |
| InChIKey | MNORRHJKCKZESK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1N)Cl)SC(=N2)Cl |
Computed by PubChem (NCBI)