2,4-Dichlorothieno[2,3-d]pyrimidine, 98%
cas: 18740-39-1 — see every product listed under this CAS number, including other names
2,4-Dichlorothieno[2,3-d]pyrimidine, 98% (CAS 18740-39-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 250mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A319798-1g |
| cas | 18740-39-1 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 10g | 487.19 Pln | |
| Ambeed | 25g | 743.06 Pln | |
| Ambeed | 100g | 2740.00 Pln | |
| Ambeed | 500g | 10761.12 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 153.30 Pln | |
| BLDpharm | 5g | 297.70 Pln | |
| BLDpharm | 10g | 519.84 Pln | |
| BLDpharm | 25g | 791.97 Pln | |
| BLDpharm | 100g | 2952.32 Pln | |
| BLDpharm | 500g | 11593.72 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2,4-dichlorothieno[2,3-d]pyrimidine (CAS 18740-39-1) is a chemical compound with the molecular formula C6H2Cl2N2S and a molecular weight of 205.06 g/mol. IUPAC name: 2,4-dichlorothieno[2,3-d]pyrimidine. InChIKey: HRXNGIQKOWQHCX-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N2S |
|---|---|
| Molecular weight | 205.06 g/mol |
| IUPAC name | 2,4-dichlorothieno[2,3-d]pyrimidine |
| InChIKey | HRXNGIQKOWQHCX-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)