CAS 36948-21-7 appears in our catalog under these names: 2,4-Dichlorothieno(3,4-d)pyrimidine, 97%, 2,4-Dichlorothieno(3,4-d)pyrimidine, 2,4-Dichlorothieno[3,4-d]pyrimidine, 94%, 94%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 0,5g, 50mg, 100mg, 250mg, 500mg.
2,4-dichlorothieno[3,4-d]pyrimidine (CAS 36948-21-7) is a chemical compound with the molecular formula C6H2Cl2N2S and a molecular weight of 205.06 g/mol. IUPAC name: 2,4-dichlorothieno[3,4-d]pyrimidine. InChIKey: FUFRGBBMQQJFMJ-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N2S |
|---|---|
| Molecular weight | 205.06 g/mol |
| IUPAC name | 2,4-dichlorothieno[3,4-d]pyrimidine |
| InChIKey | FUFRGBBMQQJFMJ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CS1)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)