CAS 699-86-5 is the registry number for 1,4-Dichlorothieno[3,4-d]pyridazine, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-dichlorothieno[3,4-d]pyridazine (CAS 699-86-5) is a chemical compound with the molecular formula C6H2Cl2N2S and a molecular weight of 205.06 g/mol. IUPAC name: 1,4-dichlorothieno[3,4-d]pyridazine. InChIKey: ZKOKXNFZOYVVCH-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N2S |
|---|---|
| Molecular weight | 205.06 g/mol |
| IUPAC name | 1,4-dichlorothieno[3,4-d]pyridazine |
| InChIKey | ZKOKXNFZOYVVCH-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CS1)C(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)