CAS 1206980-92-8 is the registry number for 2,6-Dichlorothiazolo(4,5-c)pyridine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2,6-dichloro-[1,3]thiazolo[4,5-c]pyridine (CAS 1206980-92-8) is a chemical compound with the molecular formula C6H2Cl2N2S and a molecular weight of 205.06 g/mol. IUPAC name: 2,6-dichloro-[1,3]thiazolo[4,5-c]pyridine. InChIKey: YZFIXMWOHQLSFV-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N2S |
|---|---|
| Molecular weight | 205.06 g/mol |
| IUPAC name | 2,6-dichloro-[1,3]thiazolo[4,5-c]pyridine |
| InChIKey | YZFIXMWOHQLSFV-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CN=C1Cl)N=C(S2)Cl |
Computed by PubChem (NCBI)