CAS 857970-66-2 appears in our catalog under these names: 2,5-Dichloro-[1,3]thiazolo[5,4-b]pyridine, 95%, 2,5-Dichlorothiazolo(5,4-b)pyridine, 97%, 2,5-Dichloro-(1,3)thiazolo(5,4-b)pyridine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg, 0,5g, 50mg.
2,5-dichloro-[1,3]thiazolo[5,4-b]pyridine (CAS 857970-66-2) is a chemical compound with the molecular formula C6H2Cl2N2S and a molecular weight of 205.06 g/mol. IUPAC name: 2,5-dichloro-[1,3]thiazolo[5,4-b]pyridine. InChIKey: KOZXLWYJVRDWPI-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N2S |
|---|---|
| Molecular weight | 205.06 g/mol |
| IUPAC name | 2,5-dichloro-[1,3]thiazolo[5,4-b]pyridine |
| InChIKey | KOZXLWYJVRDWPI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1N=C(S2)Cl)Cl |
Computed by PubChem (NCBI)