CAS 18740-39-1 appears in our catalog under these names: 2,4-Dichlorothieno[2,3-d]pyrimidine 98%, 2,4-Dichlorothieno[2,3-d]pyrimidine, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 500g, 1g, 5g, 10g, 25g, 100g.
2,4-dichlorothieno[2,3-d]pyrimidine (CAS 18740-39-1) is a chemical compound with the molecular formula C6H2Cl2N2S and a molecular weight of 205.06 g/mol. IUPAC name: 2,4-dichlorothieno[2,3-d]pyrimidine. InChIKey: HRXNGIQKOWQHCX-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N2S |
|---|---|
| Molecular weight | 205.06 g/mol |
| IUPAC name | 2,4-dichlorothieno[2,3-d]pyrimidine |
| InChIKey | HRXNGIQKOWQHCX-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)