Products 18740-39-1
CAS 18740-39-1 appears in our catalog under these names: 2,4-Dichlorothieno[2,3-d]pyrimidine, 95%, 2,4-Dichlorothieno[2,3-d]pyrimidine, 98%. Offered by: Fluorochem, Ambeed, BLDpharm. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 250mg.
2,4-dichlorothieno[2,3-d]pyrimidine (CAS 18740-39-1) is a chemical compound with the molecular formula C6H2Cl2N2S and a molecular weight of 205.06 g/mol. IUPAC name: 2,4-dichlorothieno[2,3-d]pyrimidine. InChIKey: HRXNGIQKOWQHCX-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N2S |
|---|---|
| Molecular weight | 205.06 g/mol |
| IUPAC name | 2,4-dichlorothieno[2,3-d]pyrimidine |
| InChIKey | HRXNGIQKOWQHCX-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)