CAS 1000709-58-9 is the registry number for 3,5-Dichloro-4-isothiocyanatopyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-dichloro-4-isothiocyanatopyridine (CAS 1000709-58-9) is a chemical compound with the molecular formula C6H2Cl2N2S and a molecular weight of 205.06 g/mol. IUPAC name: 3,5-dichloro-4-isothiocyanatopyridine. InChIKey: UZRYPJAPINSGTR-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N2S |
|---|---|
| Molecular weight | 205.06 g/mol |
| IUPAC name | 3,5-dichloro-4-isothiocyanatopyridine |
| InChIKey | UZRYPJAPINSGTR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Cl)N=C=S)Cl |
Computed by PubChem (NCBI)