Products 17821-93-1
CAS 17821-93-1 appears in our catalog under these names: 5,6-Dichlorobenzo[c][1,2,5]thiadiazole, 98%, 5,6-Dichlorobenzo[c][1,2,5]thiadiazole 98%, 5,6-Dichlorobenzo[c][1,2,5]thiadiazole, 98%, 98%, 5,6-Dichloro-2,1,3-benzothiadiazole, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 100g, 5g, 250mg, 10g, 15g, 50g.
5,6-dichloro-2,1,3-benzothiadiazole (CAS 17821-93-1) is a chemical compound with the molecular formula C6H2Cl2N2S and a molecular weight of 205.06 g/mol. IUPAC name: 5,6-dichloro-2,1,3-benzothiadiazole. InChIKey: FANYVGCAISPJSX-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N2S |
|---|---|
| Molecular weight | 205.06 g/mol |
| IUPAC name | 5,6-dichloro-2,1,3-benzothiadiazole |
| InChIKey | FANYVGCAISPJSX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=NSN=C21)Cl)Cl |
Computed by PubChem (NCBI)