CAS 1638764-42-7 is the registry number for 4,6-Dichlorothieno(2,3-d)pyrimidine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4,6-dichlorothieno[2,3-d]pyrimidine (CAS 1638764-42-7) is a chemical compound with the molecular formula C6H2Cl2N2S and a molecular weight of 205.06 g/mol. IUPAC name: 4,6-dichlorothieno[2,3-d]pyrimidine. InChIKey: HJPKDOWKUUXTPX-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N2S |
|---|---|
| Molecular weight | 205.06 g/mol |
| IUPAC name | 4,6-dichlorothieno[2,3-d]pyrimidine |
| InChIKey | HJPKDOWKUUXTPX-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1C(=NC=N2)Cl)Cl |
Computed by PubChem (NCBI)