2,4-Dimethyl-[1,1'-biphenyl]-3-ol, 95%
cas: 83451-68-7 — see every product listed under this CAS number, including other names
2,4-Dimethyl-[1,1'-biphenyl]-3-ol, 95% (CAS 83451-68-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1805826-250mg |
| cas | 83451-68-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 2489.69 Pln | |
| Ambeed | 1g | 7596.06 Pln | |
| Chemat | 50mg | 736.40 Pln | |
| Chemat | 100mg | 1206.80 Pln | |
| Chemat | 250mg | 2229.20 Pln | |
| Chemat | 1g | 6563.60 Pln | |
| BLDpharm | 50mg | 814.18 Pln | |
| BLDpharm | 100mg | 1314.01 Pln | |
| BLDpharm | 250mg | 2435.83 Pln | |
| BLDpharm | 1g | 7445.18 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2,6-dimethyl-3-phenylphenol (CAS 83451-68-7) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: 2,6-dimethyl-3-phenylphenol. InChIKey: BILVIMICBJCGQC-UHFFFAOYSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 2,6-dimethyl-3-phenylphenol |
| InChIKey | BILVIMICBJCGQC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C2=CC=CC=C2)C)O |
Computed by PubChem (NCBI)