CAS 1517-63-1 appears in our catalog under these names: 4-Methylbenzhydrol, 95%, 4–Methylbenzhydrol, 4-Methylbenzhydrol, >98.0%(GC), phenyl(p-tolyl)methanol, 97%, 97%, Phenyl(p-tolyl)methanol, 97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 100g, 25g, 250mg, 250g, 500g.
(4-methylphenyl)-phenylmethanol (CAS 1517-63-1) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: (4-methylphenyl)-phenylmethanol. InChIKey: IHASOVONMUHDND-UHFFFAOYSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | (4-methylphenyl)-phenylmethanol |
| InChIKey | IHASOVONMUHDND-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)