CAS 1883-32-5 appears in our catalog under these names: 2,2-Diphenylethanol, 98%, 2,2-Diphenylethan-1-ol, >95.0%(GC), 2,2-Diphenylethanol, 97%, 2,2-Diphenylethanol, 97%, 97%, 2,2-Diphenylethanol, 96%. Offered by: Combi-blocks, TCI, Thermo Scientific (Acros), Chemat, Fluorochem. Available pack sizes: 25g, 1g, 100g, 5g, 10g, 2g, 500g.
2,2-diphenylethanol (CAS 1883-32-5) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: 2,2-diphenylethanol. InChIKey: NYLOEXLAXYHOHH-UHFFFAOYSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 2,2-diphenylethanol |
| InChIKey | NYLOEXLAXYHOHH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CO)C2=CC=CC=C2 |
Computed by PubChem (NCBI)