cas: 942473-59-8 — see every product listed under this CAS number, including other names
2,5-Dibromo-isonicotinic acid, 96% (CAS 942473-59-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F033263-5G |
| cas | 942473-59-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 232.23 Pln | |
| Fluorochem | 10g | 372.80 Pln | |
| Fluorochem | 25g | 659.16 Pln | |
| Fluorochem | 100g | 1762.94 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
2,5-dibromopyridine-4-carboxylic acid (CAS 942473-59-8) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 2,5-dibromopyridine-4-carboxylic acid. InChIKey: CLIZDLYBXIPXCR-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 2,5-dibromopyridine-4-carboxylic acid |
| InChIKey | CLIZDLYBXIPXCR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Br)Br)C(=O)O |
Computed by PubChem (NCBI)