CAS 13958-91-3 appears in our catalog under these names: 3,5–Dibromoisonicotinic acid, 3,5-Dibromoisonicotinic acid 98%, 3,5-Dibromoisonicotinic acid, 98%, 98%, 3,5-Dibromoisonicotinic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 10g.
3,5-dibromopyridine-4-carboxylic acid (CAS 13958-91-3) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 3,5-dibromopyridine-4-carboxylic acid. InChIKey: LRKLXFGPVUZEDK-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 3,5-dibromopyridine-4-carboxylic acid |
| InChIKey | LRKLXFGPVUZEDK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Br)C(=O)O)Br |
Computed by PubChem (NCBI)