2,6-Dibromopyridine-4-carboxylic acid, 95%
cas: 2016-99-1 — see every product listed under this CAS number, including other names
2,6-Dibromopyridine-4-carboxylic acid, 95% (CAS 2016-99-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F046182-250MG |
| cas | 2016-99-1 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 185.37 Pln | |
| Fluorochem | 10g | 268.67 Pln | |
| Fluorochem | 25g | 549.82 Pln | |
| Fluorochem | 100g | 1721.29 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2,6-dibromopyridine-4-carboxylic acid (CAS 2016-99-1) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 2,6-dibromopyridine-4-carboxylic acid. InChIKey: AULQTVXAKNKCCA-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 2,6-dibromopyridine-4-carboxylic acid |
| InChIKey | AULQTVXAKNKCCA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1Br)Br)C(=O)O |
Computed by PubChem (NCBI)