cas: 161425-75-8 — see every product listed under this CAS number, including other names
2,6-Dibromoquinazoline 95% (CAS 161425-75-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A132893-100mg |
| cas | 161425-75-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 531.69 Pln | |
| Ambeed | 250mg | 832.06 Pln | |
| Ambeed | 1g | 2055.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A132893 |
2,6-dibromoquinazoline (CAS 161425-75-8) is a chemical compound with the molecular formula C8H4Br2N2 and a molecular weight of 287.94 g/mol. IUPAC name: 2,6-dibromoquinazoline. InChIKey: NAARTNANGRCYIZ-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2 |
|---|---|
| Molecular weight | 287.94 g/mol |
| IUPAC name | 2,6-dibromoquinazoline |
| InChIKey | NAARTNANGRCYIZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=NC=C2C=C1Br)Br |
Computed by PubChem (NCBI)