cas: 872509-56-3 — see every product listed under this CAS number, including other names
2,6-Dichloro-3,5-dimethoxyaniline 98% (CAS 872509-56-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A221478-250mg |
| cas | 872509-56-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 303.62 Pln | |
| Ambeed | 25g | 1115.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A221478 |
2,6-dichloro-3,5-dimethoxyaniline (CAS 872509-56-3) is a chemical compound with the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. IUPAC name: 2,6-dichloro-3,5-dimethoxyaniline. InChIKey: LCQFHEIDCMPNAN-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO2 |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | 2,6-dichloro-3,5-dimethoxyaniline |
| InChIKey | LCQFHEIDCMPNAN-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1Cl)N)Cl)OC |
Computed by PubChem (NCBI)