Products 220848-45-3

CAS 220848-45-3 is the registry number for Methyl 4-amino-2-chlorobenzoate hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 4-amino-2-chlorobenzoate;hydrochloride (CAS 220848-45-3) is a chemical compound with the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. IUPAC name: methyl 4-amino-2-chlorobenzoate;hydrochloride. InChIKey: OXWLHKCANIJVBH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9Cl2NO2
Molecular weight222.07 g/mol
IUPAC namemethyl 4-amino-2-chlorobenzoate;hydrochloride
InChIKeyOXWLHKCANIJVBH-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=C(C=C1)N)Cl.Cl

Computed by PubChem (NCBI)