CAS 872509-56-3 appears in our catalog under these names: 2,6-Dichloro-3,5-dimethoxyaniline, 97%, 2,6–Dichloro–3,5–dimethoxyaniline, 2,6-Dichloro-3,5-dimethoxyaniline 98%, 2,6-Dichloro-3,5-dimethoxyaniline, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 25g, 1g, 5g, 100mg, 50g, 100g.
2,6-dichloro-3,5-dimethoxyaniline (CAS 872509-56-3) is a chemical compound with the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. IUPAC name: 2,6-dichloro-3,5-dimethoxyaniline. InChIKey: LCQFHEIDCMPNAN-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO2 |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | 2,6-dichloro-3,5-dimethoxyaniline |
| InChIKey | LCQFHEIDCMPNAN-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1Cl)N)Cl)OC |
Computed by PubChem (NCBI)