Products 161796-15-2

CAS 161796-15-2 is the registry number for 3-Amino-4-chlorobenzoic acid methyl ester hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 3-amino-4-chlorobenzoate;hydrochloride (CAS 161796-15-2) is a chemical compound with the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. IUPAC name: methyl 3-amino-4-chlorobenzoate;hydrochloride. InChIKey: IOUBMFSWJJVNTE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9Cl2NO2
Molecular weight222.07 g/mol
IUPAC namemethyl 3-amino-4-chlorobenzoate;hydrochloride
InChIKeyIOUBMFSWJJVNTE-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C=C1)Cl)N.Cl

Computed by PubChem (NCBI)