CAS 269072-19-7 appears in our catalog under these names: Methyl 5-amino-2-chlorobenzoate hydrochloride, 95%, Methyl 5-amino-2-chlorobenzoate hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 5g, 0,25g, 2,5g.
Methyl 5-amino-2-chlorobenzoate;hydrochloride (CAS 269072-19-7) is a chemical compound with the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. IUPAC name: methyl 5-amino-2-chlorobenzoate;hydrochloride. InChIKey: UFKIEWLFIQETME-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO2 |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | methyl 5-amino-2-chlorobenzoate;hydrochloride |
| InChIKey | UFKIEWLFIQETME-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)N)Cl.Cl |
Computed by PubChem (NCBI)