cas: 872509-56-3 — see every product listed under this CAS number, including other names
2,6-Dichloro-3,5-dimethoxyaniline, 98%, 98% (CAS 872509-56-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140LY-100mg |
| cas | 872509-56-3 |
| size | 100mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 208.40 Pln | |
| Chemat | 10g | 342.80 Pln | |
| Chemat | 25g | 717.20 Pln | |
| Chemat | 50g | 1096.40 Pln | |
| Chemat | 100g | 1715.60 Pln | |
| Chemat | 250g | 2920.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,6-dichloro-3,5-dimethoxyaniline (CAS 872509-56-3) is a chemical compound with the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. IUPAC name: 2,6-dichloro-3,5-dimethoxyaniline. InChIKey: LCQFHEIDCMPNAN-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO2 |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | 2,6-dichloro-3,5-dimethoxyaniline |
| InChIKey | LCQFHEIDCMPNAN-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1Cl)N)Cl)OC |
Computed by PubChem (NCBI)