CAS 179072-14-1 appears in our catalog under these names: Methyl 5-(chloromethyl)nicotinate hydrochloride, 96%, Methyl 5–(chloromethyl)nicotinate hydrochloride, Methyl 5-(chloromethyl)nicotinate hydrochloride 97%, Methyl 5-(chloromethyl)nicotinate hydrochloride, 97%, 97%, Methyl 5-(chloromethyl)nicotinate hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
Methyl 5-(chloromethyl)pyridine-3-carboxylate;hydrochloride (CAS 179072-14-1) is a chemical compound with the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. IUPAC name: methyl 5-(chloromethyl)pyridine-3-carboxylate;hydrochloride. InChIKey: YTQKJVLJTRNZLE-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO2 |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | methyl 5-(chloromethyl)pyridine-3-carboxylate;hydrochloride |
| InChIKey | YTQKJVLJTRNZLE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=CC(=C1)CCl.Cl |
Computed by PubChem (NCBI)