Products 1619264-45-7
CAS 1619264-45-7 appears in our catalog under these names: Methyl 2-amino-6-chlorobenzoate hydrochloride, 95%, methyl 2-amino-6-chlorobenzoate hydrochloride, Methyl 2-amino-6-chlorobenzoate hydrochloride 95%, Methyl 2-amino-6-chlorobenzoate hydrochloride, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 0,25g, 2,5g, 250mg, 10g.
Methyl 2-amino-6-chlorobenzoate;hydrochloride (CAS 1619264-45-7) is a chemical compound with the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. IUPAC name: methyl 2-amino-6-chlorobenzoate;hydrochloride. InChIKey: BETFGLGULASHNN-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO2 |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | methyl 2-amino-6-chlorobenzoate;hydrochloride |
| InChIKey | BETFGLGULASHNN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC=C1Cl)N.Cl |
Computed by PubChem (NCBI)