Products 1881292-73-4
CAS 1881292-73-4 is the registry number for methyl 3-amino-5-chlorobenzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 3-amino-5-chlorobenzoate;hydrochloride (CAS 1881292-73-4) is a chemical compound with the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. IUPAC name: methyl 3-amino-5-chlorobenzoate;hydrochloride. InChIKey: ZDCUZWUCJXVKCV-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO2 |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | methyl 3-amino-5-chlorobenzoate;hydrochloride |
| InChIKey | ZDCUZWUCJXVKCV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)Cl)N.Cl |
Computed by PubChem (NCBI)