cas: 16013-85-7 — see every product listed under this CAS number, including other names
2,6-Dichloro-3-nitropyridine 98% (CAS 16013-85-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A441790-5g |
| cas | 16013-85-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 220.19 Pln | |
| Ambeed | 500g | 743.06 Pln | |
| Ambeed | 1000g | 1416.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A441790 |
2,6-dichloro-3-nitropyridine (CAS 16013-85-7) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 2,6-dichloro-3-nitropyridine. InChIKey: SHCWQWRTKPNTEM-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 2,6-dichloro-3-nitropyridine |
| InChIKey | SHCWQWRTKPNTEM-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)