cas: 16013-85-7 — see every product listed under this CAS number, including other names
2,6-Dichloro-3-nitropyridine, 97% (CAS 16013-85-7) is a chemical reagent available from Chemat. Available pack sizes: 500g, 100g, 25g, 5g, 10g, 50g, 250g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | PY-1675-500g |
| cas | 16013-85-7 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 500g | price on request | |
| Combi-blocks | 100g | price on request | |
| Combi-blocks | 25g | price on request | |
| Fluorochem | 5g | 81.24 Pln | |
| Fluorochem | 10g | 91.65 Pln | |
| Fluorochem | 25g | 102.07 Pln | |
| Fluorochem | 50g | 143.72 Pln | |
| Fluorochem | 100g | 190.58 Pln | |
| Fluorochem | 250g | 383.22 Pln | |
| Fluorochem | 500g | 706.02 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2,6-dichloro-3-nitropyridine (CAS 16013-85-7) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 2,6-dichloro-3-nitropyridine. InChIKey: SHCWQWRTKPNTEM-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 2,6-dichloro-3-nitropyridine |
| InChIKey | SHCWQWRTKPNTEM-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)