cas: 16013-85-7 — see every product listed under this CAS number, including other names
2,6-Dichloro-3-nitropyridine, 98%, 98% (CAS 16013-85-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 5kg, 10kg, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112RPE-5g |
| cas | 16013-85-7 |
| size | 5g |
| availability | 16995.47g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 100g | 146.00 Pln | |
| Chemat | 500g | 532.80 Pln | |
| Chemat | 5kg | 4728.00 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 50g | 102.80 Pln | |
| Chemat | 250g | 266.00 Pln | |
| Chemat | 1kg | 938.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,6-dichloro-3-nitropyridine (CAS 16013-85-7) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 2,6-dichloro-3-nitropyridine. InChIKey: SHCWQWRTKPNTEM-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 2,6-dichloro-3-nitropyridine |
| InChIKey | SHCWQWRTKPNTEM-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)