cas: 16013-85-7 — see every product listed under this CAS number, including other names
2,6-Dichloro-3-nitropyridine, 90%, tech. (CAS 16013-85-7) is a chemical reagent available from Chemat. Available pack sizes: 250g, 10g, 50g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 186002500 |
| cas | 16013-85-7 |
| size | 250g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 250g | 1416.52 Pln | |
| Thermo Scientific (Acros) | 10g | 126.51 Pln | |
| Thermo Scientific (Acros) | 50g | 422.73 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 90% |
2,6-dichloro-3-nitropyridine (CAS 16013-85-7) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 2,6-dichloro-3-nitropyridine. InChIKey: SHCWQWRTKPNTEM-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 2,6-dichloro-3-nitropyridine |
| InChIKey | SHCWQWRTKPNTEM-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)