cas: 2121514-53-0 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-(hydroxymethyl)phenylboronic acid (CAS 2121514-53-0) is a chemical reagent available from Chemat. Available pack sizes: 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627698-500MG |
| cas | 2121514-53-0 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 7276.62 Pln |
| delivery time | 3-4 weeks |
|---|
[2,6-dichloro-4-(hydroxymethyl)phenyl]boronic acid (CAS 2121514-53-0) is a chemical compound with the molecular formula C7H7BCl2O3 and a molecular weight of 220.84 g/mol. IUPAC name: [2,6-dichloro-4-(hydroxymethyl)phenyl]boronic acid. InChIKey: NZDFOFXGUWPQFO-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O3 |
|---|---|
| Molecular weight | 220.84 g/mol |
| IUPAC name | [2,6-dichloro-4-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | NZDFOFXGUWPQFO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1Cl)CO)Cl)(O)O |
Computed by PubChem (NCBI)